C12H9F4N3 — CID 107647069
2-N-methyl-4-N-(2,3,5,6-tetrafluorophenyl)pyridine-2,4-diamine (PubChem CID 107647069) has the molecular formula C12H9F4N3 and a molecular weight of 271.22 g/mol. Its IUPAC name is 2-N-methyl-4-N-(2,3,5,6-tetrafluorophenyl)pyridine-2,4-diamine.
| Compound Name | 2-N-methyl-4-N-(2,3,5,6-tetrafluorophenyl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 107647069 |
| Molecular Formula | C12H9F4N3 |
| Molecular Weight | 271.22 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 2-N-methyl-4-N-(2,3,5,6-tetrafluorophenyl)pyridine-2,4-diamine |
| SMILES | CNc1cc(Nc2c(F)c(F)cc(F)c2F)ccn1 |
| InChI | InChI=1S/C12H9F4N3/c1-17-9-4-6(2-3-18-9)19-12-10(15)7(13)5-8(14)11(12)16/h2-5H,1H3,(H2,17,18,19) |
| InChIKey | OCVNGNRMQDFVEH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.22 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|