C13H9F2N3 — CID 82818029
4-(2,6-difluoro-3-methylanilino)pyridine-2-carbonitrile (PubChem CID 82818029) has the molecular formula C13H9F2N3 and a molecular weight of 245.23 g/mol. Its IUPAC name is 4-(2,6-difluoro-3-methylanilino)pyridine-2-carbonitrile.
| Compound Name | 4-(2,6-difluoro-3-methylanilino)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 82818029 |
| Molecular Formula | C13H9F2N3 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 4-(2,6-difluoro-3-methylanilino)pyridine-2-carbonitrile |
| SMILES | Cc1ccc(F)c(Nc2ccnc(C#N)c2)c1F |
| InChI | InChI=1S/C13H9F2N3/c1-8-2-3-11(14)13(12(8)15)18-9-4-5-17-10(6-9)7-16/h2-6H,1H3,(H,17,18) |
| InChIKey | VVXAXHXULHSPMI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |