C7H11ClN2 — CID 54595444
N,4-dimethylpyridin-2-amine;hydrochloride (PubChem CID 54595444) has the molecular formula C7H11ClN2 and a molecular weight of 158.63 g/mol. Its IUPAC name is N,4-dimethylpyridin-2-amine;hydrochloride.
| Compound Name | N,4-dimethylpyridin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 54595444 |
| Molecular Formula | C7H11ClN2 |
| Molecular Weight | 158.63 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | N,4-dimethylpyridin-2-amine;hydrochloride |
| SMILES | CNc1cc(C)ccn1.Cl |
| InChI | InChI=1S/C7H10N2.ClH/c1-6-3-4-9-7(5-6)8-2;/h3-5H,1-2H3,(H,8,9);1H |
| InChIKey | XPWSDNFBTLZYDO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.63 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |