About CID 89289325
CID 89289325 (PubChem CID 89289325) has the molecular formula C7H10BN2O
and a molecular weight of 148.98 g/mol.
Molecular Properties
| Compound Name | CID 89289325 |
| PubChem CID | 89289325 |
| Molecular Formula | C7H10BN2O |
| Molecular Weight | 148.98 g/mol |
| Exact Mass | 149.09 |
| IUPAC Name | — |
| SMILES | CO[B]Nc1cc(C)ccn1 |
| InChI | InChI=1S/C7H10BN2O/c1-6-3-4-9-7(5-6)10-8-11-2/h3-5H,1-2H3,(H,9,10) |
| InChIKey | UNLZFCCEUNYDJB-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.98 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89289325 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89289325?
The IUPAC name of CID 89289325 (CID 89289325) is not available.
What is the SMILES notation for CID 89289325?
The canonical SMILES for CID 89289325 is CO[B]Nc1cc(C)ccn1.
What is the InChIKey of CID 89289325?
The InChIKey is UNLZFCCEUNYDJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10BN2O/c1-6-3-4-9-7(5-6)10-8-11-2/h3-5H,1-2H3,(H,9,10).
What are the key properties of CID 89289325?
CID 89289325 has a molecular weight of 148.98 g/mol, XLogP of 0.98, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89289325 is sourced from PubChem (CID 89289325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).