C22H23ClF3NO4S — CID 142538034
4-chloro-3-hydroxysulfanyl-N-(3,4,5-trifluorophenyl)benzamide;1-spiro[2.3]hexan-2-ylpropane-1,2-diol (PubChem CID 142538034) has the molecular formula C22H23ClF3NO4S and a molecular weight of 489.94 g/mol. Its IUPAC name is 4-chloro-3-hydroxysulfanyl-N-(3,4,5-trifluorophenyl)benzamide;1-spiro[2.3]hexan-2-ylpropane-1,2-diol.
| Compound Name | 4-chloro-3-hydroxysulfanyl-N-(3,4,5-trifluorophenyl)benzamide;1-spiro[2.3]hexan-2-ylpropane-1,2-diol |
|---|---|
| PubChem CID | 142538034 |
| Molecular Formula | C22H23ClF3NO4S |
| Molecular Weight | 489.94 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | 4-chloro-3-hydroxysulfanyl-N-(3,4,5-trifluorophenyl)benzamide;1-spiro[2.3]hexan-2-ylpropane-1,2-diol |
| SMILES | CC(O)C(O)C1CC12CCC2.O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(Cl)c(SO)c1 |
| InChI | InChI=1S/C13H7ClF3NO2S.C9H16O2/c14-8-2-1-6(3-11(8)21-20)13(19)18-7-4-9(15)12(17)10(16)5-7;1-6(10)8(11)7-5-9(7)3-2-4-9/h1-5,20H,(H,18,19);6-8,10-11H,2-5H2,1H3 |
| InChIKey | KVZQGWDTOOBYFE-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.94 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|