C15H9F9 — CID 144965561
1-ethyl-2,3,4,5,6-pentafluorobenzene;1,2,4,5-tetrafluoro-3-methylbenzene (PubChem CID 144965561) has the molecular formula C15H9F9 and a molecular weight of 360.22 g/mol. Its IUPAC name is 1-ethyl-2,3,4,5,6-pentafluorobenzene;1,2,4,5-tetrafluoro-3-methylbenzene.
| Compound Name | 1-ethyl-2,3,4,5,6-pentafluorobenzene;1,2,4,5-tetrafluoro-3-methylbenzene |
|---|---|
| PubChem CID | 144965561 |
| Molecular Formula | C15H9F9 |
| Molecular Weight | 360.22 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 1-ethyl-2,3,4,5,6-pentafluorobenzene;1,2,4,5-tetrafluoro-3-methylbenzene |
| SMILES | CCc1c(F)c(F)c(F)c(F)c1F.Cc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C8H5F5.C7H4F4/c1-2-3-4(9)6(11)8(13)7(12)5(3)10;1-3-6(10)4(8)2-5(9)7(3)11/h2H2,1H3;2H,1H3 |
| InChIKey | KHINUTXFBBBUJZ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.22 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|