C22H12F10 — CID 170287303
1-ethyl-2,3,4,5-tetrafluoro-6-[2,4,6-trifluoro-3-(2,3,6-trifluoro-4,5-dimethylphenyl)phenyl]benzene (PubChem CID 170287303) has the molecular formula C22H12F10 and a molecular weight of 466.32 g/mol. Its IUPAC name is 1-ethyl-2,3,4,5-tetrafluoro-6-[2,4,6-trifluoro-3-(2,3,6-trifluoro-4,5-dimethylphenyl)phenyl]benzene.
| Compound Name | 1-ethyl-2,3,4,5-tetrafluoro-6-[2,4,6-trifluoro-3-(2,3,6-trifluoro-4,5-dimethylphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 170287303 |
| Molecular Formula | C22H12F10 |
| Molecular Weight | 466.32 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | 1-ethyl-2,3,4,5-tetrafluoro-6-[2,4,6-trifluoro-3-(2,3,6-trifluoro-4,5-dimethylphenyl)phenyl]benzene |
| SMILES | CCc1c(F)c(F)c(F)c(F)c1-c1c(F)cc(F)c(-c2c(F)c(C)c(C)c(F)c2F)c1F |
| InChI | InChI=1S/C22H12F10/c1-4-8-11(19(29)22(32)21(31)17(8)27)12-9(23)5-10(24)13(18(12)28)14-15(25)6(2)7(3)16(26)20(14)30/h5H,4H2,1-3H3 |
| InChIKey | ZVVLFZSQRCDYRF-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.32 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|