C23H16F9P — CID 131969997
[4-[2,4-difluoro-5,6-dimethyl-3-(2,3,4,5-tetrafluoro-6-methylphenyl)phenyl]-2,3,5-trifluoro-6-methylphenyl]methylphosphane (PubChem CID 131969997) has the molecular formula C23H16F9P and a molecular weight of 494.34 g/mol. Its IUPAC name is [4-[2,4-difluoro-5,6-dimethyl-3-(2,3,4,5-tetrafluoro-6-methylphenyl)phenyl]-2,3,5-trifluoro-6-methylphenyl]methylphosphane.
| Compound Name | [4-[2,4-difluoro-5,6-dimethyl-3-(2,3,4,5-tetrafluoro-6-methylphenyl)phenyl]-2,3,5-trifluoro-6-methylphenyl]methylphosphane |
|---|---|
| PubChem CID | 131969997 |
| Molecular Formula | C23H16F9P |
| Molecular Weight | 494.34 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | [4-[2,4-difluoro-5,6-dimethyl-3-(2,3,4,5-tetrafluoro-6-methylphenyl)phenyl]-2,3,5-trifluoro-6-methylphenyl]methylphosphane |
| SMILES | Cc1c(C)c(-c2c(F)c(C)c(CP)c(F)c2F)c(F)c(-c2c(C)c(F)c(F)c(F)c2F)c1F |
| InChI | InChI=1S/C23H16F9P/c1-6-7(2)15(24)13(12-9(4)17(26)22(31)23(32)20(12)29)19(28)11(6)14-16(25)8(3)10(5-33)18(27)21(14)30/h5,33H2,1-4H3 |
| InChIKey | VOOPPNSNDRRWCP-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.34 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|