C38H6AlF25O3 — CID 155713114
bis[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenoxy]-[2,3,5,6-tetrafluoro-4-(2,3,6-trifluoro-4,5-dimethylphenyl)phenoxy]alumane (PubChem CID 155713114) has the molecular formula C38H6AlF25O3 and a molecular weight of 1012.39 g/mol. Its IUPAC name is bis[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenoxy]-[2,3,5,6-tetrafluoro-4-(2,3,6-trifluoro-4,5-dimethylphenyl)phenoxy]alumane.
| Compound Name | bis[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenoxy]-[2,3,5,6-tetrafluoro-4-(2,3,6-trifluoro-4,5-dimethylphenyl)phenoxy]alumane |
|---|---|
| PubChem CID | 155713114 |
| Molecular Formula | C38H6AlF25O3 |
| Molecular Weight | 1012.39 g/mol |
| Exact Mass | 1011.97 |
| IUPAC Name | bis[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenoxy]-[2,3,5,6-tetrafluoro-4-(2,3,6-trifluoro-4,5-dimethylphenyl)phenoxy]alumane |
| SMILES | Cc1c(C)c(F)c(-c2c(F)c(F)c(O[Al](Oc3c(F)c(F)c(-c4c(F)c(F)c(F)c(F)c4F)c(F)c3F)Oc3c(F)c(F)c(-c4c(F)c(F)c(F)c(F)c4F)c(F)c3F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C14H7F7O.2C12HF9O.Al/c1-3-4(2)8(16)9(17)5(7(3)15)6-10(18)12(20)14(22)13(21)11(6)19;2*13-3-1(4(14)8(18)9(19)7(3)17)2-5(15)10(20)12(22)11(21)6(2)16;/h22H,1-2H3;2*22H;/q;;;+3/p-3 |
| InChIKey | IZSLMYFDWLYROI-UHFFFAOYSA-K |
| XLogP | 13.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1012.39 |
| LogP ≤ 5 | 13.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|