C17H15F7O2 — CID 142023286
ethane;1,2,3,4-tetrafluoro-5-methyl-6-(2,3,6-trifluoro-4,5-dimethylphenyl)peroxybenzene (PubChem CID 142023286) has the molecular formula C17H15F7O2 and a molecular weight of 384.29 g/mol. Its IUPAC name is ethane;1,2,3,4-tetrafluoro-5-methyl-6-(2,3,6-trifluoro-4,5-dimethylphenyl)peroxybenzene.
| Compound Name | ethane;1,2,3,4-tetrafluoro-5-methyl-6-(2,3,6-trifluoro-4,5-dimethylphenyl)peroxybenzene |
|---|---|
| PubChem CID | 142023286 |
| Molecular Formula | C17H15F7O2 |
| Molecular Weight | 384.29 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | ethane;1,2,3,4-tetrafluoro-5-methyl-6-(2,3,6-trifluoro-4,5-dimethylphenyl)peroxybenzene |
| SMILES | CC.Cc1c(C)c(F)c(OOc2c(C)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C15H9F7O2.C2H6/c1-4-5(2)9(18)15(12(21)7(4)16)24-23-14-6(3)8(17)10(19)11(20)13(14)22;1-2/h1-3H3;1-2H3 |
| InChIKey | JMZANXFOZKWWLN-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.29 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|