C8H3Cl3F4O — CID 54011362
1,2,4,5-tetrafluoro-3-methyl-6-(trichloromethoxy)benzene (PubChem CID 54011362) has the molecular formula C8H3Cl3F4O and a molecular weight of 297.46 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-methyl-6-(trichloromethoxy)benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-methyl-6-(trichloromethoxy)benzene |
|---|---|
| PubChem CID | 54011362 |
| Molecular Formula | C8H3Cl3F4O |
| Molecular Weight | 297.46 g/mol |
| Exact Mass | 295.92 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-methyl-6-(trichloromethoxy)benzene |
| SMILES | Cc1c(F)c(F)c(OC(Cl)(Cl)Cl)c(F)c1F |
| InChI | InChI=1S/C8H3Cl3F4O/c1-2-3(12)5(14)7(6(15)4(2)13)16-8(9,10)11/h1H3 |
| InChIKey | KSPFNFFBVMSFHH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|