C8H3Cl2F4N — CID 15914785
1,1-dichloro-N-(2,3,5,6-tetrafluoro-4-methylphenyl)methanimine (PubChem CID 15914785) has the molecular formula C8H3Cl2F4N and a molecular weight of 260.02 g/mol. Its IUPAC name is 1,1-dichloro-N-(2,3,5,6-tetrafluoro-4-methylphenyl)methanimine.
| Compound Name | 1,1-dichloro-N-(2,3,5,6-tetrafluoro-4-methylphenyl)methanimine |
|---|---|
| PubChem CID | 15914785 |
| Molecular Formula | C8H3Cl2F4N |
| Molecular Weight | 260.02 g/mol |
| Exact Mass | 258.96 |
| IUPAC Name | 1,1-dichloro-N-(2,3,5,6-tetrafluoro-4-methylphenyl)methanimine |
| SMILES | Cc1c(F)c(F)c(N=C(Cl)Cl)c(F)c1F |
| InChI | InChI=1S/C8H3Cl2F4N/c1-2-3(11)5(13)7(15-8(9)10)6(14)4(2)12/h1H3 |
| InChIKey | HGSWACBEOMBVAC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.02 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|