C6AlCl2F5O — CID 139905988
dichloro-(2,3,4,5,6-pentafluorophenoxy)alumane (PubChem CID 139905988) has the molecular formula C6AlCl2F5O and a molecular weight of 280.94 g/mol. Its IUPAC name is dichloro-(2,3,4,5,6-pentafluorophenoxy)alumane.
| Compound Name | dichloro-(2,3,4,5,6-pentafluorophenoxy)alumane |
|---|---|
| PubChem CID | 139905988 |
| Molecular Formula | C6AlCl2F5O |
| Molecular Weight | 280.94 g/mol |
| Exact Mass | 279.91 |
| IUPAC Name | dichloro-(2,3,4,5,6-pentafluorophenoxy)alumane |
| SMILES | Fc1c(F)c(F)c(O[Al](Cl)Cl)c(F)c1F |
| InChI | InChI=1S/C6HF5O.Al.2ClH/c7-1-2(8)4(10)6(12)5(11)3(1)9;;;/h12H;;2*1H/q;+3;;/p-3 |
| InChIKey | INPSYJBOQAIAAR-UHFFFAOYSA-K |
| XLogP | 3.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.94 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|