C16H4AlF10NO2 — CID 155625905
bis(2,3,4,5,6-pentafluorophenoxy)-pyrrol-1-ylalumane (PubChem CID 155625905) has the molecular formula C16H4AlF10NO2 and a molecular weight of 459.18 g/mol. Its IUPAC name is bis(2,3,4,5,6-pentafluorophenoxy)-pyrrol-1-ylalumane.
| Compound Name | bis(2,3,4,5,6-pentafluorophenoxy)-pyrrol-1-ylalumane |
|---|---|
| PubChem CID | 155625905 |
| Molecular Formula | C16H4AlF10NO2 |
| Molecular Weight | 459.18 g/mol |
| Exact Mass | 458.99 |
| IUPAC Name | bis(2,3,4,5,6-pentafluorophenoxy)-pyrrol-1-ylalumane |
| SMILES | Fc1c(F)c(F)c(O[Al](Oc2c(F)c(F)c(F)c(F)c2F)n2cccc2)c(F)c1F |
| InChI | InChI=1S/2C6HF5O.C4H4N.Al/c2*7-1-2(8)4(10)6(12)5(11)3(1)9;1-2-4-5-3-1;/h2*12H;1-4H;/q;;-1;+3/p-2 |
| InChIKey | OPGXFJNIFPIWPA-UHFFFAOYSA-L |
| XLogP | 4.87 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.18 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|