C20H14AlF5O — CID 140617813
bis(2-methylphenyl)-(2,3,4,5,6-pentafluorophenoxy)alumane (PubChem CID 140617813) has the molecular formula C20H14AlF5O and a molecular weight of 392.30 g/mol. Its IUPAC name is bis(2-methylphenyl)-(2,3,4,5,6-pentafluorophenoxy)alumane.
| Compound Name | bis(2-methylphenyl)-(2,3,4,5,6-pentafluorophenoxy)alumane |
|---|---|
| PubChem CID | 140617813 |
| Molecular Formula | C20H14AlF5O |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | bis(2-methylphenyl)-(2,3,4,5,6-pentafluorophenoxy)alumane |
| SMILES | Cc1ccccc1[Al](Oc1c(F)c(F)c(F)c(F)c1F)c1ccccc1C |
| InChI | InChI=1S/2C7H7.C6HF5O.Al/c2*1-7-5-3-2-4-6-7;7-1-2(8)4(10)6(12)5(11)3(1)9;/h2*2-5H,1H3;12H;/q;;;+1/p-1 |
| InChIKey | ZBTFBALLTOXGHO-UHFFFAOYSA-M |
| XLogP | 4.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|