C30H20F5OSb — CID 133065134
(2,3,4,5,6-pentafluorophenoxy)-tetraphenyl-λ5-stibane (PubChem CID 133065134) has the molecular formula C30H20F5OSb and a molecular weight of 613.24 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenoxy)-tetraphenyl-λ5-stibane.
| Compound Name | (2,3,4,5,6-pentafluorophenoxy)-tetraphenyl-λ5-stibane |
|---|---|
| PubChem CID | 133065134 |
| Molecular Formula | C30H20F5OSb |
| Molecular Weight | 613.24 g/mol |
| Exact Mass | 612.05 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenoxy)-tetraphenyl-λ5-stibane |
| SMILES | Fc1c(F)c(F)c(O[Sb](c2ccccc2)(c2ccccc2)(c2ccccc2)c2ccccc2)c(F)c1F |
| InChI | InChI=1S/C6HF5O.4C6H5.Sb/c7-1-2(8)4(10)6(12)5(11)3(1)9;4*1-2-4-6-5-3-1;/h12H;4*1-5H;/q;;;;;+1/p-1 |
| InChIKey | BNFFLINTXYSCQR-UHFFFAOYSA-M |
| XLogP | 5.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.24 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|