C18H13F5O4 — CID 14938949
6-oxo-6-(2,3,4,5,6-pentafluorophenoxy)-4-phenylhexanoic acid (PubChem CID 14938949) has the molecular formula C18H13F5O4 and a molecular weight of 388.29 g/mol. Its IUPAC name is 6-oxo-6-(2,3,4,5,6-pentafluorophenoxy)-4-phenylhexanoic acid.
| Compound Name | 6-oxo-6-(2,3,4,5,6-pentafluorophenoxy)-4-phenylhexanoic acid |
|---|---|
| PubChem CID | 14938949 |
| Molecular Formula | C18H13F5O4 |
| Molecular Weight | 388.29 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 6-oxo-6-(2,3,4,5,6-pentafluorophenoxy)-4-phenylhexanoic acid |
| SMILES | O=C(O)CCC(CC(=O)Oc1c(F)c(F)c(F)c(F)c1F)c1ccccc1 |
| InChI | InChI=1S/C18H13F5O4/c19-13-14(20)16(22)18(17(23)15(13)21)27-12(26)8-10(6-7-11(24)25)9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,24,25) |
| InChIKey | USQAFXFCPJEDRO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.29 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|