About (tetraphenyl-λ5-stibanyl) acetate
(tetraphenyl-λ5-stibanyl) acetate (PubChem CID 16699436) has the molecular formula C26H23O2Sb
and a molecular weight of 489.23 g/mol. Its IUPAC name is (tetraphenyl-λ5-stibanyl) acetate.
Molecular Properties
| Compound Name | (tetraphenyl-λ5-stibanyl) acetate |
| PubChem CID | 16699436 |
| Molecular Formula | C26H23O2Sb |
| Molecular Weight | 489.23 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | (tetraphenyl-λ5-stibanyl) acetate |
| SMILES | CC(=O)O[Sb](c1ccccc1)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/4C6H5.C2H4O2.Sb/c4*1-2-4-6-5-3-1;1-2(3)4;/h4*1-5H;1H3,(H,3,4);/q;;;;;+1/p-1 |
| InChIKey | MOQVJYRFLPHSMW-UHFFFAOYSA-M |
| XLogP | 3.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 489.23 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (tetraphenyl-λ5-stibanyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (tetraphenyl-λ5-stibanyl) acetate?
The IUPAC name of (tetraphenyl-λ5-stibanyl) acetate (CID 16699436) is (tetraphenyl-λ5-stibanyl) acetate.
What is the SMILES notation for (tetraphenyl-λ5-stibanyl) acetate?
The canonical SMILES for (tetraphenyl-λ5-stibanyl) acetate is CC(=O)O[Sb](c1ccccc1)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of (tetraphenyl-λ5-stibanyl) acetate?
The InChIKey is MOQVJYRFLPHSMW-UHFFFAOYSA-M. The full InChI is InChI=1S/4C6H5.C2H4O2.Sb/c4*1-2-4-6-5-3-1;1-2(3)4;/h4*1-5H;1H3,(H,3,4);/q;;;;;+1/p-1.
What are the key properties of (tetraphenyl-λ5-stibanyl) acetate?
(tetraphenyl-λ5-stibanyl) acetate has a molecular weight of 489.23 g/mol, XLogP of 3.08, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (tetraphenyl-λ5-stibanyl) acetate is sourced from PubChem (CID 16699436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).