C56H44O4Sb2 — CID 16716661
bis(tetraphenyl-λ5-stibanyl) benzene-1,2-dicarboxylate (PubChem CID 16716661) has the molecular formula C56H44O4Sb2 and a molecular weight of 1024.48 g/mol. Its IUPAC name is bis(tetraphenyl-λ5-stibanyl) benzene-1,2-dicarboxylate.
| Compound Name | bis(tetraphenyl-λ5-stibanyl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 16716661 |
| Molecular Formula | C56H44O4Sb2 |
| Molecular Weight | 1024.48 g/mol |
| Exact Mass | 1022.13 |
| IUPAC Name | bis(tetraphenyl-λ5-stibanyl) benzene-1,2-dicarboxylate |
| SMILES | O=C(O[Sb](c1ccccc1)(c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1C(=O)O[Sb](c1ccccc1)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C8H6O4.8C6H5.2Sb/c9-7(10)5-3-1-2-4-6(5)8(11)12;8*1-2-4-6-5-3-1;;/h1-4H,(H,9,10)(H,11,12);8*1-5H;;/q;;;;;;;;;2*+1/p-2 |
| InChIKey | PPVDMSOIPIRJOG-UHFFFAOYSA-L |
| XLogP | 7.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1024.48 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|