C35H31F2O2Sb — CID 164890429
[tetrakis(4-methylphenyl)-λ5-stibanyl] 2,3-difluorobenzoate (PubChem CID 164890429) has the molecular formula C35H31F2O2Sb and a molecular weight of 643.39 g/mol. Its IUPAC name is [tetrakis(4-methylphenyl)-λ5-stibanyl] 2,3-difluorobenzoate.
| Compound Name | [tetrakis(4-methylphenyl)-λ5-stibanyl] 2,3-difluorobenzoate |
|---|---|
| PubChem CID | 164890429 |
| Molecular Formula | C35H31F2O2Sb |
| Molecular Weight | 643.39 g/mol |
| Exact Mass | 642.13 |
| IUPAC Name | [tetrakis(4-methylphenyl)-λ5-stibanyl] 2,3-difluorobenzoate |
| SMILES | Cc1ccc([Sb](OC(=O)c2cccc(F)c2F)(c2ccc(C)cc2)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C7H4F2O2.4C7H7.Sb/c8-5-3-1-2-4(6(5)9)7(10)11;4*1-7-5-3-2-4-6-7;/h1-3H,(H,10,11);4*3-6H,1H3;/q;;;;;+1/p-1 |
| InChIKey | FXOCPQATVAOCIB-UHFFFAOYSA-M |
| XLogP | 5.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.39 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|