About [1-(2,3-difluorophenyl)-2-methyl-1-oxopropan-2-yl] acetate
[1-(2,3-difluorophenyl)-2-methyl-1-oxopropan-2-yl] acetate (PubChem CID 146010050) has the molecular formula C12H12F2O3
and a molecular weight of 242.22 g/mol. Its IUPAC name is [1-(2,3-difluorophenyl)-2-methyl-1-oxopropan-2-yl] acetate.
Analyze [1-(2,3-difluorophenyl)-2-methyl-1-oxopropan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,3-difluorophenyl)-2-methyl-1-oxopropan-2-yl] acetate?
The IUPAC name of [1-(2,3-difluorophenyl)-2-methyl-1-oxopropan-2-yl] acetate (CID 146010050) is [1-(2,3-difluorophenyl)-2-methyl-1-oxopropan-2-yl] acetate.
What is the SMILES notation for [1-(2,3-difluorophenyl)-2-methyl-1-oxopropan-2-yl] acetate?
The canonical SMILES for [1-(2,3-difluorophenyl)-2-methyl-1-oxopropan-2-yl] acetate is CC(=O)OC(C)(C)C(=O)c1cccc(F)c1F.
What is the InChIKey of [1-(2,3-difluorophenyl)-2-methyl-1-oxopropan-2-yl] acetate?
The InChIKey is XWXPXRWWWJUTHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F2O3/c1-7(15)17-12(2,3)11(16)8-5-4-6-9(13)10(8)14/h4-6H,1-3H3.
What are the key properties of [1-(2,3-difluorophenyl)-2-methyl-1-oxopropan-2-yl] acetate?
[1-(2,3-difluorophenyl)-2-methyl-1-oxopropan-2-yl] acetate has a molecular weight of 242.22 g/mol, XLogP of 2.49, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,3-difluorophenyl)-2-methyl-1-oxopropan-2-yl] acetate is sourced from PubChem (CID 146010050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).