C15H10F4O3 — CID 22574219
methyl 2,2-bis(2,3-difluorophenyl)-2-hydroxyacetate (PubChem CID 22574219) has the molecular formula C15H10F4O3 and a molecular weight of 314.23 g/mol. Its IUPAC name is methyl 2,2-bis(2,3-difluorophenyl)-2-hydroxyacetate.
| Compound Name | methyl 2,2-bis(2,3-difluorophenyl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 22574219 |
| Molecular Formula | C15H10F4O3 |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | methyl 2,2-bis(2,3-difluorophenyl)-2-hydroxyacetate |
| SMILES | COC(=O)C(O)(c1cccc(F)c1F)c1cccc(F)c1F |
| InChI | InChI=1S/C15H10F4O3/c1-22-14(20)15(21,8-4-2-6-10(16)12(8)18)9-5-3-7-11(17)13(9)19/h2-7,21H,1H3 |
| InChIKey | VRLTWCXYOAJVBO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |