C11H13F2NO — CID 168736963
2-(2,3-difluorophenyl)-N,2-dimethylpropanamide (PubChem CID 168736963) has the molecular formula C11H13F2NO and a molecular weight of 213.23 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)-N,2-dimethylpropanamide.
| Compound Name | 2-(2,3-difluorophenyl)-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 168736963 |
| Molecular Formula | C11H13F2NO |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2-(2,3-difluorophenyl)-N,2-dimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)c1cccc(F)c1F |
| InChI | InChI=1S/C11H13F2NO/c1-11(2,10(15)14-3)7-5-4-6-8(12)9(7)13/h4-6H,1-3H3,(H,14,15) |
| InChIKey | GQBICWXOIVACPI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |