C10H9F2NO3 — CID 68606169
2-amino-3-(2,3-difluorophenyl)-2-methyl-3-oxopropanoic acid (PubChem CID 68606169) has the molecular formula C10H9F2NO3 and a molecular weight of 229.18 g/mol. Its IUPAC name is 2-amino-3-(2,3-difluorophenyl)-2-methyl-3-oxopropanoic acid.
| Compound Name | 2-amino-3-(2,3-difluorophenyl)-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 68606169 |
| Molecular Formula | C10H9F2NO3 |
| Molecular Weight | 229.18 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 2-amino-3-(2,3-difluorophenyl)-2-methyl-3-oxopropanoic acid |
| SMILES | CC(N)(C(=O)O)C(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C10H9F2NO3/c1-10(13,9(15)16)8(14)5-3-2-4-6(11)7(5)12/h2-4H,13H2,1H3,(H,15,16) |
| InChIKey | UQADILXHGFAWMU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.18 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|