C9H8F2N2O2 — CID 47224850
N'-(2,6-difluorophenyl)-N-methyloxamide (PubChem CID 47224850) has the molecular formula C9H8F2N2O2 and a molecular weight of 214.17 g/mol. Its IUPAC name is N'-(2,6-difluorophenyl)-N-methyloxamide.
| Compound Name | N'-(2,6-difluorophenyl)-N-methyloxamide |
|---|---|
| PubChem CID | 47224850 |
| Molecular Formula | C9H8F2N2O2 |
| Molecular Weight | 214.17 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | N'-(2,6-difluorophenyl)-N-methyloxamide |
| SMILES | CNC(=O)C(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C9H8F2N2O2/c1-12-8(14)9(15)13-7-5(10)3-2-4-6(7)11/h2-4H,1H3,(H,12,14)(H,13,15) |
| InChIKey | AFJYWYGNEMBDFM-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.17 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|