C12H14F2N2O3 — CID 47224631
N'-(2,6-difluorophenyl)-N-(3-methoxypropyl)oxamide (PubChem CID 47224631) has the molecular formula C12H14F2N2O3 and a molecular weight of 272.25 g/mol. Its IUPAC name is N'-(2,6-difluorophenyl)-N-(3-methoxypropyl)oxamide.
| Compound Name | N'-(2,6-difluorophenyl)-N-(3-methoxypropyl)oxamide |
|---|---|
| PubChem CID | 47224631 |
| Molecular Formula | C12H14F2N2O3 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | N'-(2,6-difluorophenyl)-N-(3-methoxypropyl)oxamide |
| SMILES | COCCCNC(=O)C(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C12H14F2N2O3/c1-19-7-3-6-15-11(17)12(18)16-10-8(13)4-2-5-9(10)14/h2,4-5H,3,6-7H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | XEDDIAZSTWMRQB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|