C9H8F2N2O3 — CID 99636399
N-(2,6-difluorophenyl)-N'-methoxyoxamide (PubChem CID 99636399) has the molecular formula C9H8F2N2O3 and a molecular weight of 230.17 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-N'-methoxyoxamide.
| Compound Name | N-(2,6-difluorophenyl)-N'-methoxyoxamide |
|---|---|
| PubChem CID | 99636399 |
| Molecular Formula | C9H8F2N2O3 |
| Molecular Weight | 230.17 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | N-(2,6-difluorophenyl)-N'-methoxyoxamide |
| SMILES | CONC(=O)C(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C9H8F2N2O3/c1-16-13-9(15)8(14)12-7-5(10)3-2-4-6(7)11/h2-4H,1H3,(H,12,14)(H,13,15) |
| InChIKey | BIOBCKZIHDDGHN-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.17 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|