About N-(5-bromo-2-fluorophenyl)-N'-methoxyoxamide
N-(5-bromo-2-fluorophenyl)-N'-methoxyoxamide (PubChem CID 99636400) has the molecular formula C9H8BrFN2O3
and a molecular weight of 291.08 g/mol. Its IUPAC name is N-(5-bromo-2-fluorophenyl)-N'-methoxyoxamide.
Molecular Properties
| Compound Name | N-(5-bromo-2-fluorophenyl)-N'-methoxyoxamide |
| PubChem CID | 99636400 |
| Molecular Formula | C9H8BrFN2O3 |
| Molecular Weight | 291.08 g/mol |
| Exact Mass | 289.97 |
| IUPAC Name | N-(5-bromo-2-fluorophenyl)-N'-methoxyoxamide |
| SMILES | CONC(=O)C(=O)Nc1cc(Br)ccc1F |
| InChI | InChI=1S/C9H8BrFN2O3/c1-16-13-9(15)8(14)12-7-4-5(10)2-3-6(7)11/h2-4H,1H3,(H,12,14)(H,13,15) |
| InChIKey | CXPKSAAFVRYGAE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.08 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(5-bromo-2-fluorophenyl)-N'-methoxyoxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-bromo-2-fluorophenyl)-N'-methoxyoxamide?
The IUPAC name of N-(5-bromo-2-fluorophenyl)-N'-methoxyoxamide (CID 99636400) is N-(5-bromo-2-fluorophenyl)-N'-methoxyoxamide.
What is the SMILES notation for N-(5-bromo-2-fluorophenyl)-N'-methoxyoxamide?
The canonical SMILES for N-(5-bromo-2-fluorophenyl)-N'-methoxyoxamide is CONC(=O)C(=O)Nc1cc(Br)ccc1F.
What is the InChIKey of N-(5-bromo-2-fluorophenyl)-N'-methoxyoxamide?
The InChIKey is CXPKSAAFVRYGAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrFN2O3/c1-16-13-9(15)8(14)12-7-4-5(10)2-3-6(7)11/h2-4H,1H3,(H,12,14)(H,13,15).
What are the key properties of N-(5-bromo-2-fluorophenyl)-N'-methoxyoxamide?
N-(5-bromo-2-fluorophenyl)-N'-methoxyoxamide has a molecular weight of 291.08 g/mol, XLogP of 1.20, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-bromo-2-fluorophenyl)-N'-methoxyoxamide is sourced from PubChem (CID 99636400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).