C11H13F2NO3 — CID 104643872
methyl 3-(2,6-difluoroanilino)-2-hydroxy-2-methylpropanoate (PubChem CID 104643872) has the molecular formula C11H13F2NO3 and a molecular weight of 245.22 g/mol. Its IUPAC name is methyl 3-(2,6-difluoroanilino)-2-hydroxy-2-methylpropanoate.
| Compound Name | methyl 3-(2,6-difluoroanilino)-2-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 104643872 |
| Molecular Formula | C11H13F2NO3 |
| Molecular Weight | 245.22 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | methyl 3-(2,6-difluoroanilino)-2-hydroxy-2-methylpropanoate |
| SMILES | COC(=O)C(C)(O)CNc1c(F)cccc1F |
| InChI | InChI=1S/C11H13F2NO3/c1-11(16,10(15)17-2)6-14-9-7(12)4-3-5-8(9)13/h3-5,14,16H,6H2,1-2H3 |
| InChIKey | VVVXWOUAKCGGKV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |