C12H13FN2O3 — CID 104643983
methyl 3-(2-cyano-3-fluoroanilino)-2-hydroxy-2-methylpropanoate (PubChem CID 104643983) has the molecular formula C12H13FN2O3 and a molecular weight of 252.25 g/mol. Its IUPAC name is methyl 3-(2-cyano-3-fluoroanilino)-2-hydroxy-2-methylpropanoate.
| Compound Name | methyl 3-(2-cyano-3-fluoroanilino)-2-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 104643983 |
| Molecular Formula | C12H13FN2O3 |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | methyl 3-(2-cyano-3-fluoroanilino)-2-hydroxy-2-methylpropanoate |
| SMILES | COC(=O)C(C)(O)CNc1cccc(F)c1C#N |
| InChI | InChI=1S/C12H13FN2O3/c1-12(17,11(16)18-2)7-15-10-5-3-4-9(13)8(10)6-14/h3-5,15,17H,7H2,1-2H3 |
| InChIKey | NVVVMOCHRHPCKA-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |