C12H11F3O3 — CID 146008063
[2-methyl-1-oxo-1-(3,4,5-trifluorophenyl)propan-2-yl] acetate (PubChem CID 146008063) has the molecular formula C12H11F3O3 and a molecular weight of 260.21 g/mol. Its IUPAC name is [2-methyl-1-oxo-1-(3,4,5-trifluorophenyl)propan-2-yl] acetate.
| Compound Name | [2-methyl-1-oxo-1-(3,4,5-trifluorophenyl)propan-2-yl] acetate |
|---|---|
| PubChem CID | 146008063 |
| Molecular Formula | C12H11F3O3 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | [2-methyl-1-oxo-1-(3,4,5-trifluorophenyl)propan-2-yl] acetate |
| SMILES | CC(=O)OC(C)(C)C(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C12H11F3O3/c1-6(16)18-12(2,3)11(17)7-4-8(13)10(15)9(14)5-7/h4-5H,1-3H3 |
| InChIKey | UWXHDLNPTRQGGZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|