C12H15F2NS — CID 174890711
N-tert-butylsulfanyl-1-(2,3-difluorophenyl)ethanimine (PubChem CID 174890711) has the molecular formula C12H15F2NS and a molecular weight of 243.32 g/mol. Its IUPAC name is N-tert-butylsulfanyl-1-(2,3-difluorophenyl)ethanimine.
| Compound Name | N-tert-butylsulfanyl-1-(2,3-difluorophenyl)ethanimine |
|---|---|
| PubChem CID | 174890711 |
| Molecular Formula | C12H15F2NS |
| Molecular Weight | 243.32 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | N-tert-butylsulfanyl-1-(2,3-difluorophenyl)ethanimine |
| SMILES | CC(=NSC(C)(C)C)c1cccc(F)c1F |
| InChI | InChI=1S/C12H15F2NS/c1-8(15-16-12(2,3)4)9-6-5-7-10(13)11(9)14/h5-7H,1-4H3 |
| InChIKey | KEWMRCOJWZSWIF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.32 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|