About N-tert-butyl-4-(2,3-difluorophenyl)pent-3-en-1-amine
N-tert-butyl-4-(2,3-difluorophenyl)pent-3-en-1-amine (PubChem CID 79606963) has the molecular formula C15H21F2N
and a molecular weight of 253.34 g/mol. Its IUPAC name is N-tert-butyl-4-(2,3-difluorophenyl)pent-3-en-1-amine.
Molecular Properties
| Compound Name | N-tert-butyl-4-(2,3-difluorophenyl)pent-3-en-1-amine |
| PubChem CID | 79606963 |
| Molecular Formula | C15H21F2N |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | N-tert-butyl-4-(2,3-difluorophenyl)pent-3-en-1-amine |
| SMILES | CC(=CCCNC(C)(C)C)c1cccc(F)c1F |
| InChI | InChI=1S/C15H21F2N/c1-11(7-6-10-18-15(2,3)4)12-8-5-9-13(16)14(12)17/h5,7-9,18H,6,10H2,1-4H3 |
| InChIKey | SQXWTURFBHCGKD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-4-(2,3-difluorophenyl)pent-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-4-(2,3-difluorophenyl)pent-3-en-1-amine?
The IUPAC name of N-tert-butyl-4-(2,3-difluorophenyl)pent-3-en-1-amine (CID 79606963) is N-tert-butyl-4-(2,3-difluorophenyl)pent-3-en-1-amine.
What is the SMILES notation for N-tert-butyl-4-(2,3-difluorophenyl)pent-3-en-1-amine?
The canonical SMILES for N-tert-butyl-4-(2,3-difluorophenyl)pent-3-en-1-amine is CC(=CCCNC(C)(C)C)c1cccc(F)c1F.
What is the InChIKey of N-tert-butyl-4-(2,3-difluorophenyl)pent-3-en-1-amine?
The InChIKey is SQXWTURFBHCGKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21F2N/c1-11(7-6-10-18-15(2,3)4)12-8-5-9-13(16)14(12)17/h5,7-9,18H,6,10H2,1-4H3.
What are the key properties of N-tert-butyl-4-(2,3-difluorophenyl)pent-3-en-1-amine?
N-tert-butyl-4-(2,3-difluorophenyl)pent-3-en-1-amine has a molecular weight of 253.34 g/mol, XLogP of 4.15, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-4-(2,3-difluorophenyl)pent-3-en-1-amine is sourced from PubChem (CID 79606963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).