C16H22F3NOS — CID 156745497
3-[3-[(E)-N-tert-butylsulfanyl-C-methylcarbonimidoyl]-2-fluorophenyl]-3,3-difluoro-2-methylpropan-1-ol (PubChem CID 156745497) has the molecular formula C16H22F3NOS and a molecular weight of 333.42 g/mol. Its IUPAC name is 3-[3-[(E)-N-tert-butylsulfanyl-C-methylcarbonimidoyl]-2-fluorophenyl]-3,3-difluoro-2-methylpropan-1-ol.
| Compound Name | 3-[3-[(E)-N-tert-butylsulfanyl-C-methylcarbonimidoyl]-2-fluorophenyl]-3,3-difluoro-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 156745497 |
| Molecular Formula | C16H22F3NOS |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 3-[3-[(E)-N-tert-butylsulfanyl-C-methylcarbonimidoyl]-2-fluorophenyl]-3,3-difluoro-2-methylpropan-1-ol |
| SMILES | C/C(=N\SC(C)(C)C)c1cccc(C(F)(F)C(C)CO)c1F |
| InChI | InChI=1S/C16H22F3NOS/c1-10(9-21)16(18,19)13-8-6-7-12(14(13)17)11(2)20-22-15(3,4)5/h6-8,10,21H,9H2,1-5H3/b20-11+ |
| InChIKey | OHPMAKNPQIHDIJ-RGVLZGJSSA-N |
| XLogP | 4.80 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|