C15H20F3NOS — CID 164919356
1-[3-[(Z)-N-tert-butylsulfanyl-C-methylcarbonimidoyl]-2-fluorophenyl]-1,1-difluoropropan-2-ol (PubChem CID 164919356) has the molecular formula C15H20F3NOS and a molecular weight of 319.39 g/mol. Its IUPAC name is 1-[3-[(Z)-N-tert-butylsulfanyl-C-methylcarbonimidoyl]-2-fluorophenyl]-1,1-difluoropropan-2-ol.
| Compound Name | 1-[3-[(Z)-N-tert-butylsulfanyl-C-methylcarbonimidoyl]-2-fluorophenyl]-1,1-difluoropropan-2-ol |
|---|---|
| PubChem CID | 164919356 |
| Molecular Formula | C15H20F3NOS |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 1-[3-[(Z)-N-tert-butylsulfanyl-C-methylcarbonimidoyl]-2-fluorophenyl]-1,1-difluoropropan-2-ol |
| SMILES | C/C(=N/SC(C)(C)C)c1cccc(C(F)(F)C(C)O)c1F |
| InChI | InChI=1S/C15H20F3NOS/c1-9(19-21-14(3,4)5)11-7-6-8-12(13(11)16)15(17,18)10(2)20/h6-8,10,20H,1-5H3/b19-9- |
| InChIKey | GPLSMVJMRZWEBK-OCKHKDLRSA-N |
| XLogP | 4.55 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|