About 2-(tetraethyl-λ5-phosphanyl)oxycarbonylbenzoic acid
2-(tetraethyl-λ5-phosphanyl)oxycarbonylbenzoic acid (PubChem CID 67930573) has the molecular formula C16H25O4P
and a molecular weight of 312.35 g/mol. Its IUPAC name is 2-(tetraethyl-λ5-phosphanyl)oxycarbonylbenzoic acid.
Molecular Properties
| Compound Name | 2-(tetraethyl-λ5-phosphanyl)oxycarbonylbenzoic acid |
| PubChem CID | 67930573 |
| Molecular Formula | C16H25O4P |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2-(tetraethyl-λ5-phosphanyl)oxycarbonylbenzoic acid |
| SMILES | CCP(CC)(CC)(CC)OC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C16H25O4P/c1-5-21(6-2,7-3,8-4)20-16(19)14-12-10-9-11-13(14)15(17)18/h9-12H,5-8H2,1-4H3,(H,17,18) |
| InChIKey | BSHGROZGAMZFLC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(tetraethyl-λ5-phosphanyl)oxycarbonylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(tetraethyl-λ5-phosphanyl)oxycarbonylbenzoic acid?
The IUPAC name of 2-(tetraethyl-λ5-phosphanyl)oxycarbonylbenzoic acid (CID 67930573) is 2-(tetraethyl-λ5-phosphanyl)oxycarbonylbenzoic acid.
What is the SMILES notation for 2-(tetraethyl-λ5-phosphanyl)oxycarbonylbenzoic acid?
The canonical SMILES for 2-(tetraethyl-λ5-phosphanyl)oxycarbonylbenzoic acid is CCP(CC)(CC)(CC)OC(=O)c1ccccc1C(=O)O.
What is the InChIKey of 2-(tetraethyl-λ5-phosphanyl)oxycarbonylbenzoic acid?
The InChIKey is BSHGROZGAMZFLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25O4P/c1-5-21(6-2,7-3,8-4)20-16(19)14-12-10-9-11-13(14)15(17)18/h9-12H,5-8H2,1-4H3,(H,17,18).
What are the key properties of 2-(tetraethyl-λ5-phosphanyl)oxycarbonylbenzoic acid?
2-(tetraethyl-λ5-phosphanyl)oxycarbonylbenzoic acid has a molecular weight of 312.35 g/mol, XLogP of 4.09, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(tetraethyl-λ5-phosphanyl)oxycarbonylbenzoic acid is sourced from PubChem (CID 67930573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).