About 1-methoxypropane;phthalic acid
1-methoxypropane;phthalic acid (PubChem CID 174535712) has the molecular formula C12H16O5
and a molecular weight of 240.25 g/mol. Its IUPAC name is 1-methoxypropane;phthalic acid.
Molecular Properties
| Compound Name | 1-methoxypropane;phthalic acid |
| PubChem CID | 174535712 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 1-methoxypropane;phthalic acid |
| SMILES | CCCOC.O=C(O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C8H6O4.C4H10O/c9-7(10)5-3-1-2-4-6(5)8(11)12;1-3-4-5-2/h1-4H,(H,9,10)(H,11,12);3-4H2,1-2H3 |
| InChIKey | WVFJXKSGMOGDNH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methoxypropane;phthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypropane;phthalic acid?
The IUPAC name of 1-methoxypropane;phthalic acid (CID 174535712) is 1-methoxypropane;phthalic acid.
What is the SMILES notation for 1-methoxypropane;phthalic acid?
The canonical SMILES for 1-methoxypropane;phthalic acid is CCCOC.O=C(O)c1ccccc1C(=O)O.
What is the InChIKey of 1-methoxypropane;phthalic acid?
The InChIKey is WVFJXKSGMOGDNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O4.C4H10O/c9-7(10)5-3-1-2-4-6(5)8(11)12;1-3-4-5-2/h1-4H,(H,9,10)(H,11,12);3-4H2,1-2H3.
What are the key properties of 1-methoxypropane;phthalic acid?
1-methoxypropane;phthalic acid has a molecular weight of 240.25 g/mol, XLogP of 2.13, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropane;phthalic acid is sourced from PubChem (CID 174535712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).