C8H9AlF2O — CID 139709302
(2,6-difluorophenoxy)-dimethylalumane (PubChem CID 139709302) has the molecular formula C8H9AlF2O and a molecular weight of 186.14 g/mol. Its IUPAC name is (2,6-difluorophenoxy)-dimethylalumane.
| Compound Name | (2,6-difluorophenoxy)-dimethylalumane |
|---|---|
| PubChem CID | 139709302 |
| Molecular Formula | C8H9AlF2O |
| Molecular Weight | 186.14 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | (2,6-difluorophenoxy)-dimethylalumane |
| SMILES | C[Al](C)Oc1c(F)cccc1F |
| InChI | InChI=1S/C6H4F2O.2CH3.Al/c7-4-2-1-3-5(8)6(4)9;;;/h1-3,9H;2*1H3;/q;;;+1/p-1 |
| InChIKey | XRZVWETYOIVJEU-UHFFFAOYSA-M |
| XLogP | 2.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.14 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |