About 5-(2,6-difluorophenoxy)-3-methyl-1,2,4-thiadiazole
5-(2,6-difluorophenoxy)-3-methyl-1,2,4-thiadiazole (PubChem CID 133425367) has the molecular formula C9H6F2N2OS
and a molecular weight of 228.22 g/mol. Its IUPAC name is 5-(2,6-difluorophenoxy)-3-methyl-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 5-(2,6-difluorophenoxy)-3-methyl-1,2,4-thiadiazole |
| PubChem CID | 133425367 |
| Molecular Formula | C9H6F2N2OS |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 5-(2,6-difluorophenoxy)-3-methyl-1,2,4-thiadiazole |
| SMILES | Cc1nsc(Oc2c(F)cccc2F)n1 |
| InChI | InChI=1S/C9H6F2N2OS/c1-5-12-9(15-13-5)14-8-6(10)3-2-4-7(8)11/h2-4H,1H3 |
| InChIKey | WAUGANRIWDBOOO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2,6-difluorophenoxy)-3-methyl-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,6-difluorophenoxy)-3-methyl-1,2,4-thiadiazole?
The IUPAC name of 5-(2,6-difluorophenoxy)-3-methyl-1,2,4-thiadiazole (CID 133425367) is 5-(2,6-difluorophenoxy)-3-methyl-1,2,4-thiadiazole.
What is the SMILES notation for 5-(2,6-difluorophenoxy)-3-methyl-1,2,4-thiadiazole?
The canonical SMILES for 5-(2,6-difluorophenoxy)-3-methyl-1,2,4-thiadiazole is Cc1nsc(Oc2c(F)cccc2F)n1.
What is the InChIKey of 5-(2,6-difluorophenoxy)-3-methyl-1,2,4-thiadiazole?
The InChIKey is WAUGANRIWDBOOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F2N2OS/c1-5-12-9(15-13-5)14-8-6(10)3-2-4-7(8)11/h2-4H,1H3.
What are the key properties of 5-(2,6-difluorophenoxy)-3-methyl-1,2,4-thiadiazole?
5-(2,6-difluorophenoxy)-3-methyl-1,2,4-thiadiazole has a molecular weight of 228.22 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,6-difluorophenoxy)-3-methyl-1,2,4-thiadiazole is sourced from PubChem (CID 133425367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).