C24F20OP+ — CID 132529451
(2,3,4,5,6-pentafluorophenoxy)-tris(2,3,4,5,6-pentafluorophenyl)phosphanium (PubChem CID 132529451) has the molecular formula C24F20OP+ and a molecular weight of 715.20 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenoxy)-tris(2,3,4,5,6-pentafluorophenyl)phosphanium.
| Compound Name | (2,3,4,5,6-pentafluorophenoxy)-tris(2,3,4,5,6-pentafluorophenyl)phosphanium |
|---|---|
| PubChem CID | 132529451 |
| Molecular Formula | C24F20OP+ |
| Molecular Weight | 715.20 g/mol |
| Exact Mass | 714.94 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenoxy)-tris(2,3,4,5,6-pentafluorophenyl)phosphanium |
| SMILES | Fc1c(F)c(F)c(O[P+](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24F20OP/c25-1-5(29)13(37)21(14(38)6(1)30)45-46(22-15(39)7(31)2(26)8(32)16(22)40,23-17(41)9(33)3(27)10(34)18(23)42)24-19(43)11(35)4(28)12(36)20(24)44/q+1 |
| InChIKey | ORDKUWXFVPOCIY-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.20 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|