About CID 136671200
CID 136671200 (PubChem CID 136671200) has the molecular formula C7F5OSSe
and a molecular weight of 306.09 g/mol.
Molecular Properties
| Compound Name | CID 136671200 |
| PubChem CID | 136671200 |
| Molecular Formula | C7F5OSSe |
| Molecular Weight | 306.09 g/mol |
| Exact Mass | 306.88 |
| IUPAC Name | — |
| SMILES | Fc1c(F)c(F)c(OC(=S)[Se])c(F)c1F |
| InChI | InChI=1S/C7F5OSSe/c8-1-2(9)4(11)6(13-7(14)15)5(12)3(1)10 |
| InChIKey | KYYKTEKHSYKYSE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.09 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze CID 136671200 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136671200?
The IUPAC name of CID 136671200 (CID 136671200) is not available.
What is the SMILES notation for CID 136671200?
The canonical SMILES for CID 136671200 is Fc1c(F)c(F)c(OC(=S)[Se])c(F)c1F.
What is the InChIKey of CID 136671200?
The InChIKey is KYYKTEKHSYKYSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7F5OSSe/c8-1-2(9)4(11)6(13-7(14)15)5(12)3(1)10.
What are the key properties of CID 136671200?
CID 136671200 has a molecular weight of 306.09 g/mol, XLogP of 2.21, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136671200 is sourced from PubChem (CID 136671200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).