C9H2ClF5O2 — CID 23163869
(2,3,4,5,6-pentafluorophenyl) 2-chloroprop-2-enoate (PubChem CID 23163869) has the molecular formula C9H2ClF5O2 and a molecular weight of 272.56 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2-chloroprop-2-enoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 2-chloroprop-2-enoate |
|---|---|
| PubChem CID | 23163869 |
| Molecular Formula | C9H2ClF5O2 |
| Molecular Weight | 272.56 g/mol |
| Exact Mass | 271.97 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2-chloroprop-2-enoate |
| SMILES | C=C(Cl)C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C9H2ClF5O2/c1-2(10)9(16)17-8-6(14)4(12)3(11)5(13)7(8)15/h1H2 |
| InChIKey | ANCKEKKCCMMMJX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.56 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|