C19H13F11O6 — CID 135222150
bis(2,2,2-trifluoroethyl) 2-methylidenebutanedioate;(2,3,4,5,6-pentafluorophenyl) 2-methylprop-2-enoate (PubChem CID 135222150) has the molecular formula C19H13F11O6 and a molecular weight of 546.29 g/mol. Its IUPAC name is bis(2,2,2-trifluoroethyl) 2-methylidenebutanedioate;(2,3,4,5,6-pentafluorophenyl) 2-methylprop-2-enoate.
| Compound Name | bis(2,2,2-trifluoroethyl) 2-methylidenebutanedioate;(2,3,4,5,6-pentafluorophenyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 135222150 |
| Molecular Formula | C19H13F11O6 |
| Molecular Weight | 546.29 g/mol |
| Exact Mass | 546.05 |
| IUPAC Name | bis(2,2,2-trifluoroethyl) 2-methylidenebutanedioate;(2,3,4,5,6-pentafluorophenyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1c(F)c(F)c(F)c(F)c1F.C=C(CC(=O)OCC(F)(F)F)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C10H5F5O2.C9H8F6O4/c1-3(2)10(16)17-9-7(14)5(12)4(11)6(13)8(9)15;1-5(7(17)19-4-9(13,14)15)2-6(16)18-3-8(10,11)12/h1H2,2H3;1-4H2 |
| InChIKey | CBDNQJNMYMGCCG-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.29 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|