C10H3F5O4 — CID 173353746
4-oxo-4-(2,3,4,5,6-pentafluorophenoxy)but-2-enoic acid (PubChem CID 173353746) has the molecular formula C10H3F5O4 and a molecular weight of 282.12 g/mol. Its IUPAC name is 4-oxo-4-(2,3,4,5,6-pentafluorophenoxy)but-2-enoic acid.
| Compound Name | 4-oxo-4-(2,3,4,5,6-pentafluorophenoxy)but-2-enoic acid |
|---|---|
| PubChem CID | 173353746 |
| Molecular Formula | C10H3F5O4 |
| Molecular Weight | 282.12 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | 4-oxo-4-(2,3,4,5,6-pentafluorophenoxy)but-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H3F5O4/c11-5-6(12)8(14)10(9(15)7(5)13)19-4(18)2-1-3(16)17/h1-2H,(H,16,17) |
| InChIKey | PKDMGHPCURZISI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.12 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|