4-oxo-4-(2,3,4,5,6-pentafluorophenoxy)but-2-enoic acid

C10H3F5O4 — CID 173353746

IUPAC4-oxo-4-(2,3,4,5,6-pentafluorophenoxy)but-2-enoic acid
SMILESO=C(O)C=CC(=O)Oc1c(F)c(F)c(F)c(F)c1F
InChIInChI=1S/C10H3F5O4/c11-5-6(12)8(14)10(9(15)7(5)13)19-4(18)2-1-3(16)17/h1-2H,(H,16,17)
InChIKeyPKDMGHPCURZISI-UHFFFAOYSA-N
MW282.12 g/mol
LogP1.93
Rot. Bonds3

About 4-oxo-4-(2,3,4,5,6-pentafluorophenoxy)but-2-enoic acid

4-oxo-4-(2,3,4,5,6-pentafluorophenoxy)but-2-enoic acid (PubChem CID 173353746) has the molecular formula C10H3F5O4 and a molecular weight of 282.12 g/mol. Its IUPAC name is 4-oxo-4-(2,3,4,5,6-pentafluorophenoxy)but-2-enoic acid.

Molecular Properties

Compound Name4-oxo-4-(2,3,4,5,6-pentafluorophenoxy)but-2-enoic acid
PubChem CID173353746
Molecular FormulaC10H3F5O4
Molecular Weight282.12 g/mol
Exact Mass282.00
IUPAC Name4-oxo-4-(2,3,4,5,6-pentafluorophenoxy)but-2-enoic acid
SMILESO=C(O)C=CC(=O)Oc1c(F)c(F)c(F)c(F)c1F
InChIInChI=1S/C10H3F5O4/c11-5-6(12)8(14)10(9(15)7(5)13)19-4(18)2-1-3(16)17/h1-2H,(H,16,17)
InChIKeyPKDMGHPCURZISI-UHFFFAOYSA-N
XLogP1.93
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.12
LogP ≤ 51.93
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze 4-oxo-4-(2,3,4,5,6-pentafluorophenoxy)but-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-oxo-4-(2,3,4,5,6-pentafluorophenoxy)but-2-enoic acid?
The IUPAC name of 4-oxo-4-(2,3,4,5,6-pentafluorophenoxy)but-2-enoic acid (CID 173353746) is 4-oxo-4-(2,3,4,5,6-pentafluorophenoxy)but-2-enoic acid.
What is the SMILES notation for 4-oxo-4-(2,3,4,5,6-pentafluorophenoxy)but-2-enoic acid?
The canonical SMILES for 4-oxo-4-(2,3,4,5,6-pentafluorophenoxy)but-2-enoic acid is O=C(O)C=CC(=O)Oc1c(F)c(F)c(F)c(F)c1F.
What is the InChIKey of 4-oxo-4-(2,3,4,5,6-pentafluorophenoxy)but-2-enoic acid?
The InChIKey is PKDMGHPCURZISI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H3F5O4/c11-5-6(12)8(14)10(9(15)7(5)13)19-4(18)2-1-3(16)17/h1-2H,(H,16,17).
What are the key properties of 4-oxo-4-(2,3,4,5,6-pentafluorophenoxy)but-2-enoic acid?
4-oxo-4-(2,3,4,5,6-pentafluorophenoxy)but-2-enoic acid has a molecular weight of 282.12 g/mol, XLogP of 1.93, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-4-(2,3,4,5,6-pentafluorophenoxy)but-2-enoic acid is sourced from PubChem (CID 173353746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).