C18H24F5N3OP+ — CID 10076714
(2,3,4,5,6-pentafluorophenoxy)-tripyrrolidin-1-ylphosphanium (PubChem CID 10076714) has the molecular formula C18H24F5N3OP+ and a molecular weight of 424.37 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenoxy)-tripyrrolidin-1-ylphosphanium.
| Compound Name | (2,3,4,5,6-pentafluorophenoxy)-tripyrrolidin-1-ylphosphanium |
|---|---|
| PubChem CID | 10076714 |
| Molecular Formula | C18H24F5N3OP+ |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenoxy)-tripyrrolidin-1-ylphosphanium |
| SMILES | Fc1c(F)c(F)c(O[P+](N2CCCC2)(N2CCCC2)N2CCCC2)c(F)c1F |
| InChI | InChI=1S/C18H24F5N3OP/c19-13-14(20)16(22)18(17(23)15(13)21)27-28(24-7-1-2-8-24,25-9-3-4-10-25)26-11-5-6-12-26/h1-12H2/q+1 |
| InChIKey | CJIJVIZVISEEAO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|