C15H16F5N2O+ — CID 10917808
1-[(2,3,4,5,6-pentafluorophenoxy)-pyrrolidin-1-ium-1-ylidenemethyl]pyrrolidine (PubChem CID 10917808) has the molecular formula C15H16F5N2O+ and a molecular weight of 335.30 g/mol. Its IUPAC name is 1-[(2,3,4,5,6-pentafluorophenoxy)-pyrrolidin-1-ium-1-ylidenemethyl]pyrrolidine.
| Compound Name | 1-[(2,3,4,5,6-pentafluorophenoxy)-pyrrolidin-1-ium-1-ylidenemethyl]pyrrolidine |
|---|---|
| PubChem CID | 10917808 |
| Molecular Formula | C15H16F5N2O+ |
| Molecular Weight | 335.30 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 1-[(2,3,4,5,6-pentafluorophenoxy)-pyrrolidin-1-ium-1-ylidenemethyl]pyrrolidine |
| SMILES | Fc1c(F)c(F)c(OC(N2CCCC2)=[N+]2CCCC2)c(F)c1F |
| InChI | InChI=1S/C15H16F5N2O/c16-9-10(17)12(19)14(13(20)11(9)18)23-15(21-5-1-2-6-21)22-7-3-4-8-22/h1-8H2/q+1 |
| InChIKey | QZIASGUALNKPRI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.30 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|