About CID 163905895
CID 163905895 (PubChem CID 163905895) has the molecular formula C9H9FI-
and a molecular weight of 263.07 g/mol.
Molecular Properties
| Compound Name | CID 163905895 |
| PubChem CID | 163905895 |
| Molecular Formula | C9H9FI- |
| Molecular Weight | 263.07 g/mol |
| Exact Mass | 262.97 |
| IUPAC Name | — |
| SMILES | CCc1cc2c(c(C)c1F)[I-]2 |
| InChI | InChI=1S/C9H9FI/c1-3-6-4-7-9(11-7)5(2)8(6)10/h4H,3H2,1-2H3/q-1 |
| InChIKey | LOEPFYWNQSFADL-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.07 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 163905895 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163905895?
The IUPAC name of CID 163905895 (CID 163905895) is not available.
What is the SMILES notation for CID 163905895?
The canonical SMILES for CID 163905895 is CCc1cc2c(c(C)c1F)[I-]2.
What is the InChIKey of CID 163905895?
The InChIKey is LOEPFYWNQSFADL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FI/c1-3-6-4-7-9(11-7)5(2)8(6)10/h4H,3H2,1-2H3/q-1.
What are the key properties of CID 163905895?
CID 163905895 has a molecular weight of 263.07 g/mol, XLogP of -0.86, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163905895 is sourced from PubChem (CID 163905895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).