C14H17F3O2S — CID 14678244
4-hydroxy-5-methyl-6-[4-(trifluoromethyl)phenyl]sulfanylhexan-2-one (PubChem CID 14678244) has the molecular formula C14H17F3O2S and a molecular weight of 306.35 g/mol. Its IUPAC name is 4-hydroxy-5-methyl-6-[4-(trifluoromethyl)phenyl]sulfanylhexan-2-one.
| Compound Name | 4-hydroxy-5-methyl-6-[4-(trifluoromethyl)phenyl]sulfanylhexan-2-one |
|---|---|
| PubChem CID | 14678244 |
| Molecular Formula | C14H17F3O2S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 4-hydroxy-5-methyl-6-[4-(trifluoromethyl)phenyl]sulfanylhexan-2-one |
| SMILES | CC(=O)CC(O)C(C)CSc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17F3O2S/c1-9(13(19)7-10(2)18)8-20-12-5-3-11(4-6-12)14(15,16)17/h3-6,9,13,19H,7-8H2,1-2H3 |
| InChIKey | HZGANQJKHBQNHK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |