C13H13F5O3S — CID 11121471
(3R,4R)-5,5,6,6,6-pentafluoro-4-hydroxy-3-(4-methylphenyl)sulfanylhexanoic acid (PubChem CID 11121471) has the molecular formula C13H13F5O3S and a molecular weight of 344.30 g/mol. Its IUPAC name is (3R,4R)-5,5,6,6,6-pentafluoro-4-hydroxy-3-(4-methylphenyl)sulfanylhexanoic acid.
| Compound Name | (3R,4R)-5,5,6,6,6-pentafluoro-4-hydroxy-3-(4-methylphenyl)sulfanylhexanoic acid |
|---|---|
| PubChem CID | 11121471 |
| Molecular Formula | C13H13F5O3S |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | (3R,4R)-5,5,6,6,6-pentafluoro-4-hydroxy-3-(4-methylphenyl)sulfanylhexanoic acid |
| SMILES | Cc1ccc(S[C@H](CC(=O)O)[C@H](O)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H13F5O3S/c1-7-2-4-8(5-3-7)22-9(6-10(19)20)11(21)12(14,15)13(16,17)18/h2-5,9,11,21H,6H2,1H3,(H,19,20)/t9-,11+/m1/s1 |
| InChIKey | LCLHLYNKLVLFLH-KOLCDFICSA-N |
| XLogP | 3.49 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|