C13H11F5O2S — CID 10881933
(4R,5R)-4-(4-methylphenyl)sulfanyl-5-(1,1,2,2,2-pentafluoroethyl)oxolan-2-one (PubChem CID 10881933) has the molecular formula C13H11F5O2S and a molecular weight of 326.29 g/mol. Its IUPAC name is (4R,5R)-4-(4-methylphenyl)sulfanyl-5-(1,1,2,2,2-pentafluoroethyl)oxolan-2-one.
| Compound Name | (4R,5R)-4-(4-methylphenyl)sulfanyl-5-(1,1,2,2,2-pentafluoroethyl)oxolan-2-one |
|---|---|
| PubChem CID | 10881933 |
| Molecular Formula | C13H11F5O2S |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | (4R,5R)-4-(4-methylphenyl)sulfanyl-5-(1,1,2,2,2-pentafluoroethyl)oxolan-2-one |
| SMILES | Cc1ccc(S[C@@H]2CC(=O)O[C@@H]2C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H11F5O2S/c1-7-2-4-8(5-3-7)21-9-6-10(19)20-11(9)12(14,15)13(16,17)18/h2-5,9,11H,6H2,1H3/t9-,11+/m1/s1 |
| InChIKey | JXVGZYKZVWOHEQ-KOLCDFICSA-N |
| XLogP | 3.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|